|
|
| | 3,7-Dimethyl-benzofuran-2-carboxylic acid Basic information |
| Product Name: | 3,7-Dimethyl-benzofuran-2-carboxylic acid | | Synonyms: | ASINEX-REAG BAS 12719308;3,7-dimethyl-1-benzofuran-2-carboxylic acid;2-Benzofurancarboxylic acid, 3,7-dimethyl-;3,7-Dimethyl-2-benzofurancarboxylic Acid;Lifitegrast Impurity 58;3,7-Dimethyl-benzofuran-2-carboxylic acid | | CAS: | 16817-24-6 | | MF: | C11H10O3 | | MW: | 190.2 | | EINECS: | | | Product Categories: | | | Mol File: | 16817-24-6.mol |  |
| | 3,7-Dimethyl-benzofuran-2-carboxylic acid Chemical Properties |
| Melting point | 212 °C | | Boiling point | 345.1±37.0 °C(Predicted) | | density | 1.256±0.06 g/cm3(Predicted) | | form | solid | | pka | 2.92±0.30(Predicted) | | InChI | 1S/C11H10O3/c1-6-4-3-5-8-7(2)10(11(12)13)14-9(6)8/h3-5H,1-2H3,(H,12,13) | | InChIKey | KUEJSYJMMRPGTH-UHFFFAOYSA-N | | SMILES | Cc1cccc2c(C)c(oc12)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 3,7-Dimethyl-benzofuran-2-carboxylic acid Usage And Synthesis |
| | 3,7-Dimethyl-benzofuran-2-carboxylic acid Preparation Products And Raw materials |
|