|
|
| | Isooctyl thioglycolate Basic information |
| Product Name: | Isooctyl thioglycolate | | Synonyms: | THIOGLYCOLIC ACID ISOOCTYL ESTER;ACETIC ACID, MERCAPTO, ISOOCTYL ESTER;MERCAPTOACETIC ACID ISOOCTYL ESTER;IOTG;IOTG(TM);ISOOCTYLTHIOGLYCOLLATE;6-Methylheptyl sulfanylacetate;isooctylmercaptoacetate | | CAS: | 25103-09-7 | | MF: | C10H20O2S | | MW: | 204.33 | | EINECS: | 246-613-9 | | Product Categories: | | | Mol File: | 25103-09-7.mol |  |
| | Isooctyl thioglycolate Chemical Properties |
| Melting point | <-50°C | | Boiling point | 96°C | | density | 0,97 g/cm3 | | vapor pressure | 3.1Pa at 20℃ | | refractive index | 1.4590 to 1.4640 | | Fp | 133°C | | storage temp. | Store below +30°C. | | form | liquid | | Water Solubility | 10.6mg/L at 20℃ | | Cosmetics Ingredients Functions | HAIR WAVING OR STRAIGHTENING | | Cosmetic Ingredient Review (CIR) | ISOOCTYL THIOGLYCOLATE (25103-09-7) | | InChI | InChI=1S/C10H20O2S/c1-9(2)6-4-3-5-7-12-10(11)8-13/h9,13H,3-8H2,1-2H3 | | InChIKey | RZBBHEJLECUBJT-UHFFFAOYSA-N | | SMILES | C(=O)(CS)OCCCCCC(C)C | | LogP | 3.68 at 20℃ | | CAS DataBase Reference | 25103-09-7(CAS DataBase Reference) | | EPA Substance Registry System | Acetic acid, mercapto-, isooctyl ester (25103-09-7) |
| Risk Statements | 22 | | Safety Statements | 24 | | RIDADR | 2810 | | RTECS | AI7300000 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29309090 | | Hazardous Substances Data | 25103-09-7(Hazardous Substances Data) | | Toxicity | rabbit,LDLo,oral,1200mg/kg (1200mg/kg),Journal of Economic Entomology. Vol. 48, Pg. 139, 1955. |
| | Isooctyl thioglycolate Usage And Synthesis |
| Chemical Properties | Water-white liquid; faint fruity odor. Combustible. | | Uses | Antioxidants, fungicides, oil additives, plasticizers, insecticides, stabilizers, polymerization
modifiers, stabilizer in tin-sulfur compounds, stripping agent for polysulfide rubber. | | Hazard | Toxic by ingestion. | | Synthesis | Chloroacetic acid and isooctyl alcohol are esterified in the presence of toluene solvent and sulfuric acid catalyst to produce isooctyl chloroacetate. After neutralization, sodium thiosulfate is added and reacted in ethanol solvent to produce sodium thiosulfate isooctyl chloroacetate. Then, acid hydrolysis is carried out with hydrochloric acid to produce Isooctyl thioglycolate. |
| | Isooctyl thioglycolate Preparation Products And Raw materials |
|