|
|
| | 1-BENZOFURAN-5-AMINE Basic information |
| Product Name: | 1-BENZOFURAN-5-AMINE | | Synonyms: | 5-Amino-1-benzofuran;5-Amino-1-benzofuran 97%;1-BENZOFURAN-5-AMINE;5-Aminobenzo[b]furan 97%;1-Benzofuran-5-amine, Benzo[b]furan-5-amine;Vilazodone Impurity 11;5-amino Benzofuran;5-Aminobenzo[b]furan97% | | CAS: | 58546-89-7 | | MF: | C8H7NO | | MW: | 133.15 | | EINECS: | | | Product Categories: | | | Mol File: | 58546-89-7.mol |  |
| | 1-BENZOFURAN-5-AMINE Chemical Properties |
| Boiling point | 259.8±13.0 °C(Predicted) | | density | 1.225±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 3.87±0.10(Predicted) | | form | liquid | | color | Orange | | InChI | InChI=1S/C8H7NO/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H,9H2 | | InChIKey | GMOLCSICTCPZCU-UHFFFAOYSA-N | | SMILES | O1C2=CC=C(N)C=C2C=C1 |
| Hazard Note | Harmful | | HS Code | 2932990090 |
| | 1-BENZOFURAN-5-AMINE Usage And Synthesis |
| Uses | 5-Benzofuranamine acts as a reagent in the synthesis of substituted pyrimidines as multi-targeted receptor tyrosine kinase and microtubule inhibitors as potential antitumor agents. | | Definition | ChEBI: 1-Benzofuran-5-amine is a member of benzofurans. | | Synthesis | Step 1. 5-Nitrobenzofuran (Compound 104, 1.89 g, 11.63 mmol), iron powder (6.5 g, 116 mmol), 36.5% hydrochloric acid (1 mL), ethanol (30 mL), and water (6 mL) were mixed, stirred, and heated to 100 °C, and the reaction was maintained for 3 hours. After completion of the reaction, the precipitate was filtered and washed with ethanol. The filtrates were combined and the solvent was removed by evaporation to give a residue. The residue was dissolved in dichloromethane (50 mL) and the organic layer was washed sequentially with aqueous sodium bicarbonate (20 mL x 2) and brine (20 mL x 1), dried over magnesium sulfate, filtered and the solvent was evaporated to afford 1-benzofuran-5-amine (Compound 105) as a brown solid (0.8 g, 51% yield).LC-MS: 134 [M + 1]+; 1H NMR ( DMSO-d6): δ 4.8 (s, 2H), 6.57 (m, 1H), 6.67 (m, 1H), 6.69 (m, 1H), 7.21 (d, J = 9.3 Hz, 1H), 7.74 (d, J = 2.4 Hz, 1H). | | References | [1] Patent: US2009/76044, 2009, A1. Location in patent: Page/Page column 25 |
| | 1-BENZOFURAN-5-AMINE Preparation Products And Raw materials |
|