|
|
| | 1-(3-Trifluoromethylphenyl)piperazine hydrochloride Basic information |
| | 1-(3-Trifluoromethylphenyl)piperazine hydrochloride Chemical Properties |
| Melting point | 239-241 °C(lit.) | | Fp | 9℃ | | storage temp. | Refrigerator | | solubility | methanol:glacial acetic acid (1:1): soluble25mg/mL | | form | Solid | | color | White | | BRN | 8357534 | | Stability: | Hygroscopic | | Major Application | forensics and toxicology | | InChI | 1S/C11H13F3N2.ClH/c12-11(13,14)9-2-1-3-10(8-9)16-6-4-15-5-7-16;/h1-3,8,15H,4-7H2;1H | | InChIKey | DGNLGWJZZZOYPT-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1cc(ccc1)N2CC[N+H2]CC2.[Cl-] | | CAS DataBase Reference | 16015-69-3(CAS DataBase Reference) |
| Hazard Codes | Xi,T,F | | Risk Statements | 36/37/38-39/23/24/25-23/24/25-11 | | Safety Statements | 26-36-45-36/37-16-7 | | RIDADR | 3276 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29339900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| | 1-(3-Trifluoromethylphenyl)piperazine hydrochloride Usage And Synthesis |
| Chemical Properties | 1-(3-Trifluoromethylphenyl)piperazine hydrochloride is White Solid | | Uses | 1-(3-Trifluoromethylphenyl)piperazine hydrochloride used as reference materials for forensic laboratories. They affect the central and the autonomic nervous systems, the blood pressure, and smooth muscle. | | General Description | A Snap-N-Spike reference Solution suitable for use in LC/MS or GC/MS applications for clinical toxicology, forensic analysis, urine drug testing, or pharmaceutical research. 3-Trifluoromethylphenylpiperazine, or TFMPP, is a recreational drug and stimulant sold illicitly under the street name “Legal X.” TFMPP is a structural analog of benzylpiperazine or BZP. |
| | 1-(3-Trifluoromethylphenyl)piperazine hydrochloride Preparation Products And Raw materials |
|