- Calcium acetylacetonate
-
- $5580.00 / 1T
-
2025-12-03
- CAS:19372-44-2
- Min. Order: 1T
- Purity: 98%
- Supply Ability: 1-10000kg
|
| | Calcium acetylacetonate Basic information |
| | Calcium acetylacetonate Chemical Properties |
| Melting point | 175°C (dec.) | | density | 1.371[at 20℃] | | vapor pressure | 0.01Pa at 25℃ | | storage temp. | RT, stored under nitrogen | | form | Powder | | color | white | | Water Solubility | 11.9 g/l | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | InChI=1S/C5H7O2.Ca/c1-4(6)3-5(2)7;/h3H,1-2H3;/q-1;+2 | | InChIKey | CVKLJNZPNLIMCK-UHFFFAOYSA-N | | SMILES | [CH-](C(=O)C)C(=O)C.[Ca+2] | | LogP | -1.1 at 22℃ | | CAS DataBase Reference | 19372-44-2(CAS DataBase Reference) | | EPA Substance Registry System | 2,4-Pentanedione, ion(1-), calcium (19372-44-2) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-63-22 | | Safety Statements | 26-36/37/39 | | TSCA | TSCA listed | | HS Code | 29141900 | | Toxicity | oral rat, LD50: 1,250 mg/kg |
| Provider | Language |
|
ALFA
| English |
| | Calcium acetylacetonate Usage And Synthesis |
| Chemical Properties | White or off-white crystal | | Uses | calcium acetylacetonate is the most ordinary heat stabilizer for halogenated polymers such as PVC. It can also be used as catalyst, cross-linking agent, resin hardening accelerant, resin and rubber additive, etc. | | Flammability and Explosibility | Non flammable |
| | Calcium acetylacetonate Preparation Products And Raw materials |
|