n-Caproic acid sodium salt manufacturers
|
| | n-Caproic acid sodium salt Basic information |
| Product Name: | n-Caproic acid sodium salt | | Synonyms: | CAPROIC ACID SODIUM SALT;HEXANOIC ACID SODIUM SALT;SODIUM N-HEXANOATE;SODIUM CAPROATE;N-HEXANOIC ACID SODIUM SALT;Sodiumn-caproate;N-caproic acid sodium;CAPROIC ACID SODIUM SALT FOR GC | | CAS: | 10051-44-2 | | MF: | C6H11NaO2 | | MW: | 138.14 | | EINECS: | 233-179-0 | | Product Categories: | | | Mol File: | 10051-44-2.mol |  |
| | n-Caproic acid sodium salt Chemical Properties |
| Melting point | 350 °C | | storage temp. | Inert atmosphere,2-8°C | | Water Solubility | almost transparency in Water | | form | Powder | | color | White | | BRN | 3631527 | | InChI | InChI=1S/C6H12O2.Na/c1-2-3-4-5-6(7)8;/h2-5H2,1H3,(H,7,8);/q;+1/p-1 | | InChIKey | UDWXLZLRRVQONG-UHFFFAOYSA-M | | SMILES | C(C([O-])=O)CCCC.[Na+] | | CAS DataBase Reference | 10051-44-2(CAS DataBase Reference) | | EPA Substance Registry System | Hexanoic acid, sodium salt (10051-44-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2915.90.5050 | | Storage Class | 11 - Combustible Solids |
| | n-Caproic acid sodium salt Usage And Synthesis |
| Uses | Sodium Hexanoate is a reagent used in the synthesis of biodegradable biopolymers with improved service properties. | | Definition | ChEBI: An organic sodium salt resulting from the replacement of the proton from the carboxy group of hexanoic acid by a sodium ion. |
| | n-Caproic acid sodium salt Preparation Products And Raw materials |
|