| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Methyl Methacrylate-d5 CAS:55935-46-1 Remarks:CS-C-02528
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Methyl methacrylate-d5 CAS:55935-46-1 Purity:>=98 atom % D, >=99% (CP), contains hydroquinone as stabiliz Package:5G Remarks:448842-5G
|
| Company Name: |
Shanghai Yufei Pharmaceutical Technology Co., Ltd.
|
| Tel: |
+8618221552033 |
| Email: |
edward-atom@hotmail.com |
| Products Intro: |
Product Name:Methyl Methacrylate-d5 (stabilized with hydroquinone) CAS:55935-46-1 Purity:99% HPLC 99% D Package:100mg;1g;10g;500g;1kg
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:Methyl methacrylate-d5 >=98 atom % D, >=99% (CP), contains hydroquinone as stabilizer CAS:55935-46-1 Purity:>=99% (CP) Package:5g Remarks:NULL
|
|
| | METHYL METHACRYLATE-D5 Basic information |
| | METHYL METHACRYLATE-D5 Chemical Properties |
| Melting point | -48 °C (lit.) | | Boiling point | 100 °C (lit.) | | density | 0.983 g/mL at 25 °C | | refractive index | n20/D 1.413(lit.) | | Fp | 50 °F | | storage temp. | 2-8°C | | InChI | 1S/C5H8O2/c1-4(2)5(6)7-3/h1H2,2-3H3/i1D2,2D3 | | InChIKey | VVQNEPGJFQJSBK-KPAILUHGSA-N | | SMILES | [2H]\C([2H])=C(\C(=O)OC)C([2H])([2H])[2H] |
| Hazard Codes | F,Xi | | Risk Statements | 11-37/38-43 | | Safety Statements | 24-37-46 | | RIDADR | UN 1247 3/PG 2 | | WGK Germany | 1 | | RTECS | OZ5075000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | METHYL METHACRYLATE-D5 Usage And Synthesis |
| Uses | Methyl Methacrylate-d5 (CAS# 55935-46-1) is a useful isotopically labeled research compound. |
| | METHYL METHACRYLATE-D5 Preparation Products And Raw materials |
|