|
|
| | 4-(4-Methylpiperazino)-1,2-benzenediamine Basic information |
| Product Name: | 4-(4-Methylpiperazino)-1,2-benzenediamine | | Synonyms: | 4-(4-Methylpiperazino)-1,2-benzenediamine 4HCl;4-(4-methyl-piperazin-1-yl)-2-amino-aniline;1,2-Benzenediamine,4-(4-methyl-1-piperazinyl)-;4-(4-Methylpiperazino)-1,2-benzenediamine-8;4-(4-METHYLPIPERAZINO)-1,2-BENZENEDIAMINE;4-(4-methylpiperazin-1-yl)benzene-1,2-diamine;4-(4-Methyl-1-piperazinyl)-1,2-benzenediamine;4-(4-methylpiperazino)-1,2-diaminobenzene | | CAS: | 54998-08-2 | | MF: | C11H18N4 | | MW: | 206.29 | | EINECS: | | | Product Categories: | | | Mol File: | 54998-08-2.mol |  |
| | 4-(4-Methylpiperazino)-1,2-benzenediamine Chemical Properties |
| Melting point | 118-120°C | | Boiling point | 419.7±45.0 °C(Predicted) | | density | 1.163±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 7.84±0.42(Predicted) | | form | solid | | color | Off-white (material may darken on storage) | | InChI | InChI=1S/C11H18N4/c1-14-4-6-15(7-5-14)9-2-3-10(12)11(13)8-9/h2-3,8H,4-7,12-13H2,1H3 | | InChIKey | RTDKAEOVZXYWJW-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(N2CCN(C)CC2)C=C1N |
| | 4-(4-Methylpiperazino)-1,2-benzenediamine Usage And Synthesis |
| | 4-(4-Methylpiperazino)-1,2-benzenediamine Preparation Products And Raw materials |
|