- 1-Ethylcyclohexanol
-
- $0.10 / 1KG
-
2025-12-24
- CAS:1940-18-7
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10
- 1-Ethyl-cyclohexanol
-
- $0.00 / 10kg
-
2025-10-24
- CAS:1940-18-7
- Min. Order: 100kg
- Purity: 99%min
- Supply Ability: 10 tons
- 1-Ethylcyclohexanol
-
- $200.00 / 1KG
-
2025-09-25
- CAS:1940-18-7
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 1-Ethylcyclohexanol Basic information | | Uses |
| Product Name: | 1-Ethylcyclohexanol | | Synonyms: | 1-Ethylcyclohexanol 1940-18-7;1-Ethylcyclohexan-1-ol 1940-18-7;1-ETHYL-1-CYCLOHEXANOL;1-Ethyl-1-hydroxycyclohexane;1-Ethylcyclohexan-1-ol;1-Ethylcyclohexane-1-ol;1-ETHYLCYCLOHEXANOL;1-Aethyl-cyclohexanol-(1) | | CAS: | 1940-18-7 | | MF: | C8H16O | | MW: | 128.21 | | EINECS: | 621-537-2 | | Product Categories: | | | Mol File: | 1940-18-7.mol |  |
| | 1-Ethylcyclohexanol Chemical Properties |
| Melting point | 34.5°C | | Boiling point | 168°C(lit.) | | density | 0.9227 | | refractive index | 1.4640 to 1.4680 | | storage temp. | 2-8°C | | pka | 15.38±0.20(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C8H16O/c1-2-8(9)6-4-3-5-7-8/h9H,2-7H2,1H3 | | InChIKey | BUCJHJXFXUZJHL-UHFFFAOYSA-N | | SMILES | C1(CC)(O)CCCCC1 | | CAS DataBase Reference | 1940-18-7(CAS DataBase Reference) | | NIST Chemistry Reference | Cyclohexanol, 1-ethyl-(1940-18-7) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RTECS | GV9040000 | | HS Code | 2906190090 | | Toxicity | mouse,LD50,intraperitoneal,840mg/kg (840mg/kg),Arzneimittel-Forschung. Drug Research. Vol. 5, Pg. 161, 1955. |
| | 1-Ethylcyclohexanol Usage And Synthesis |
| Uses | 1-Ethylcyclohexanol is an alcohol derivative used in organic synthesis and experimental research. | | Synthesis Reference(s) | Tetrahedron Letters, 25, p. 5897, 1984 DOI: 10.1016/S0040-4039(01)81714-7 |
| | 1-Ethylcyclohexanol Preparation Products And Raw materials |
|