- Butylpyrrolidone
-
- $0.00 / 200kg
-
2025-10-31
- CAS:3470-98-2
- Min. Order: 20kg
- Purity: 99%
- Supply Ability: 20 tons
|
| | 1-Butylpyrrolidin-2-one Basic information |
| | 1-Butylpyrrolidin-2-one Chemical Properties |
| Boiling point | 137 °C / 28mmHg | | density | 0,96 g/cm3 | | vapor pressure | 13Pa at 25℃ | | refractive index | 1.4640 to 1.4660 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly) | | form | Oil | | pka | -0.41±0.20(Predicted) | | color | Colourless | | Water Solubility | 1000g/L at 20℃ | | InChI | InChI=1S/C8H15NO/c1-2-3-6-9-7-4-5-8(9)10/h2-7H2,1H3 | | InChIKey | BNXZHVUCNYMNOS-UHFFFAOYSA-N | | SMILES | N1(CCCC)CCCC1=O | | LogP | 1.265 at 20℃ | | CAS DataBase Reference | 3470-98-2(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Pyrrolidinone, 1-butyl-(3470-98-2) | | EPA Substance Registry System | 2-Pyrrolidinone, 1-butyl- (3470-98-2) |
| Safety Statements | 23-24/25 | | RTECS | UY5746000 | | HS Code | 2933790030 | | Toxicity | mouse,LD50,intraperitoneal,500mg/kg (500mg/kg),BEHAVIORAL: ANTIPSYCHOTICBEHAVIORAL: ATAXIA,Journal of Pharmaceutical Sciences. Vol. 60, Pg. 1058, 1971. |
| | 1-Butylpyrrolidin-2-one Usage And Synthesis |
| Chemical Properties | corlorless clear liquid | | Flammability and Explosibility | Not classified |
| | 1-Butylpyrrolidin-2-one Preparation Products And Raw materials |
|