| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (2,2-Dimethyl-1-methylenepropoxy)trimethylsilane Basic information |
| Product Name: | (2,2-Dimethyl-1-methylenepropoxy)trimethylsilane | | Synonyms: | (1-TERT-BUTYLVINYLOXY)TRIMETHYLSILANE;PINACOLONE TRIMETHYLSILYL ENOL ETHER;T-BUTYLVINYLOXYTRIMETHYLSILANE;TERT-BUTYLVINYLOXYTRIMETHYLSILANE;(2,2-Dimethyl-1-methylenepropoxy)trimethylsilane, 3,3-Dimethyl-2-trimethylsiloxy-1-butene, Pinacolone enol trimethylsilyl ether;(1-tert-Butylvinyloxy)triMethylsilane 98%;Silane, (2,2-dimethyl-1-methylenepropoxy)trimethyl-;3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane | | CAS: | 17510-46-2 | | MF: | C9H20OSi | | MW: | 172.34 | | EINECS: | | | Product Categories: | | | Mol File: | 17510-46-2.mol |  |
| | (2,2-Dimethyl-1-methylenepropoxy)trimethylsilane Chemical Properties |
| Boiling point | 140-142 °C(lit.) | | density | 0.798 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.409(lit.) | | Fp | 76 °F | | form | liquid | | BRN | 2204704 | | InChI | 1S/C9H20OSi/c1-8(9(2,3)4)10-11(5,6)7/h1H2,2-7H3 | | InChIKey | PEHJULPJEVIIFJ-UHFFFAOYSA-N | | SMILES | CC(C)(C)C(=C)O[Si](C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | 3.2 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | (2,2-Dimethyl-1-methylenepropoxy)trimethylsilane Usage And Synthesis |
| Uses | (1-tert-Butylvinyloxy)trimethylsilane ((2,2-Dimethyl-1-methylenepropoxy)trimethylsilane) may be used in the synthesis of cis-3,3-dimethyl-1-(6-phenethyl-3,6-dihydro-2H-pyran-2-yl)butan-2-one. | | General Description | (1-tert-Butylvinyloxy)trimethylsilane is a silyl enol. It belongs to organosilicone class of compounds. Enthalpy of vaporization of (1-tert-Butylvinyloxy)trimethylsilane at boiling point has been reported. |
| | (2,2-Dimethyl-1-methylenepropoxy)trimethylsilane Preparation Products And Raw materials |
|