| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
Chromone-3-carboxylic acid manufacturers
|
| | Chromone-3-carboxylic acid Basic information |
| | Chromone-3-carboxylic acid Chemical Properties |
| Melting point | 202-205 °C (lit.) | | Boiling point | 245.64°C (rough estimate) | | density | 1.493 | | refractive index | 1.4440 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 2.55±0.20(Predicted) | | color | Pale Yellow | | BRN | 1074111 | | InChI | InChI=1S/C10H6O4/c11-9-6-3-1-2-4-8(6)14-5-7(9)10(12)13/h1-5H,(H,12,13) | | InChIKey | PCIITXGDSHXTSN-UHFFFAOYSA-N | | SMILES | C1OC2=CC=CC=C2C(=O)C=1C(O)=O | | CAS DataBase Reference | 39079-62-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids |
| | Chromone-3-carboxylic acid Usage And Synthesis |
| Chemical Properties | light beige crystalline powder | | Uses | Chromone-3-carboxylic acid may be used in the preparation of:
- chromane-2,4-diones
- chromone-3-carboxamides
- 5-(2-hydroxyphenyl)isoxazole
- chromone-2-carboxamides
- chromone-2-carboxamido-3-esters
| | Definition | ChEBI: Chromone-3-carboxylic acid is a member of chromones. | | Synthesis Reference(s) | Synthetic Communications, 10, p. 889, 1980 DOI: 10.1080/00397918008061846 | | General Description | Chromone-3-carboxylic acid is a chromone derivative. Its potential as an antioxidant in charge transfer (CT) processes has been assessed by surface-enhanced Raman scattering (SERS) analysis of chromone 3-carboxylic acid adsorbed on silver colloids. |
| | Chromone-3-carboxylic acid Preparation Products And Raw materials |
|