| Company Name: |
Nanjing Haolv Biotechnology Co.,Ltd
|
| Tel: |
025-84622273 17361806303 |
| Email: |
kexin.zhou@haolvbiotech.com |
| Products Intro: |
Product Name:Cholestane-2,2,4,4-d4
CAS:205529-74-4
Purity:98% Package:5g;25g;100g
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:α-Cholestane-d4
CAS:205529-74-4
Purity:NULL Package:50mg;5mg Remarks:NULL
|
| Company Name: |
ChengDu SinoStandards Bio-Tech Co.,Ltd. ，
|
| Tel: |
028-83243028 19136088901 |
| Email: |
sinostandards@163.com |
| Products Intro: |
Product Name:5alpha-Cholestane-2,2,4,4-d4
CAS:205529-74-4
Purity:标准品 Package:10mg;100mg;1g
|
| Company Name: |
Manhag Testing Technology Co., Ltd
|
| Tel: |
400-818 0104 18918165978 |
| Email: |
zilin.ren@bestown.net.cn |
| Products Intro: |
Product Name:Cholestane-2244-[d4]
CAS:205529-74-4
Purity:10mg Package:10mg
|
| Company Name: |
Yancheng Tongming Biotechnology Co., Ltd.
|
| Tel: |
15195160625 |
| Email: |
2863565288@qq.com |
| Products Intro: |
Product Name:5α-Cholestane-2,2,4,4-d4
CAS:205529-74-4
Purity:98% HPLC Package:0.01 g In Stock
0.05 g In Stock
|
|
| | D4 C27 ALPHA ALPHA ALPHA (20R) CHOLESTANE Basic information |
| Product Name: | D4 C27 ALPHA ALPHA ALPHA (20R) CHOLESTANE | | Synonyms: | D4 C27 ALPHA ALPHA ALPHA (20R) CHOLESTANE;d4 C27 ααα (20R)-Cholestane;(5R,8R,9S,10S,13R,14S,17R)-2,2,4,4-tetradeuterio-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1~{H}-cyclopenta[a]phenanthrene;α-Cholestane-d4;5α-Cholestane-2,2,4,4-d4;5alpha-Cholestane-2,2,4,4-d4;d4 C27 ααα (20R)-Cholestane in isooctane;5α-Cholestane-2,2,4,4-d4 | | CAS: | 205529-74-4 | | MF: | C27H44D4 | | MW: | 376.69 | | EINECS: | | | Product Categories: | | | Mol File: | 205529-74-4.mol |  |
| | D4 C27 ALPHA ALPHA ALPHA (20R) CHOLESTANE Chemical Properties |
| solubility | Chloroform (Slightly), DMSO (Slightly) | | form | solid | | color | White to off-white | | InChIKey | XIIAYQZJNBULGD-ZMFVDLGJSA-N | | SMILES | C[C@@]12[C@](CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCCC(C)C)([H])C([2H])([2H])CC([2H])([2H])C1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | D4 C27 ALPHA ALPHA ALPHA (20R) CHOLESTANE Usage And Synthesis |
| Uses | Labelled a-Cholestane (C431700). a-Cholestane is the trans-decalin homolog of Coprostane. |
| | D4 C27 ALPHA ALPHA ALPHA (20R) CHOLESTANE Preparation Products And Raw materials |
|