|
|
| | (4-Methylphenyl)diphenyl sulfonium trifluoromethanesulfonate Basic information |
| Product Name: | (4-Methylphenyl)diphenyl sulfonium trifluoromethanesulfonate | | Synonyms: | (4-METHYLPHENYL)DIPHENYLSULFONIUM TRIFLATE;DIPHENYL(4-METHYLPHENYL)SULFONIUM TRIFLATE;DIPHENYL-4-METHYLPHENYLSULFONIUM TRIFLUOROMETHANESULFONATE;DIPHENYL(4-METHYLPHENYL)SULPHONIUM TRIFLATE;(4-METHYLPHENYL)DIPHENYLSULFONIUM TRIFLA;(4-methylphenyl)-diphenylsulfonium;Diphenyl(p-tolyl)sulfonium trifluoromethanesulfonate;(4-methylphenyl)-diphenylsulfanium | | CAS: | 81416-37-7 | | MF: | C20H17F3O3S2 | | MW: | 426.47 | | EINECS: | | | Product Categories: | | | Mol File: | 81416-37-7.mol |  |
| | (4-Methylphenyl)diphenyl sulfonium trifluoromethanesulfonate Chemical Properties |
| Melting point | 98-102 °C(lit.) | | form | solid | | color | Yellow-brown | | InChI | InChI=1S/C19H17S.CHF3O3S/c1-16-12-14-19(15-13-16)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18;2-1(3,4)8(5,6)7/h2-15H,1H3;(H,5,6,7)/q+1;/p-1 | | InChIKey | AWOATHYNVXCSGP-UHFFFAOYSA-M | | SMILES | [S+](C1=CC=CC=C1)(C1C=CC=CC=1)C1C=CC(C)=CC=1.C(F)(F)(F)S([O-])(=O)=O |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HS Code | 2930909899 |
| | (4-Methylphenyl)diphenyl sulfonium trifluoromethanesulfonate Usage And Synthesis |
| | (4-Methylphenyl)diphenyl sulfonium trifluoromethanesulfonate Preparation Products And Raw materials |
|