|
|
| | AC-IEPD-PNA Basic information |
| Product Name: | AC-IEPD-PNA | | Synonyms: | N-ACETYL-ILE-GLU-PRO-ASP-P-NITROANILINE;AC-IEPD-PNA;AC-ILE-GLU-PRO-ASP-PARANITROANILIDE;AC-ILE-GLU-PRO-ASP-PNA;N-ACETYL-ILE-GLU-PRO-ASP-P-NITROANILIDE;AC-IETD-PNA;GRANZYME B SUBSTRATE VIII, COLORIMETRIC;N-Acetyl-Ile-Glu-Pro-Asp-p-nitroanilide;L-α-Asparagine, N-acetyl-L-isoleucyl-L-α-glutamyl-L-prolyl-N-(4-nitrophenyl)- (9CI) | | CAS: | 216757-29-8 | | MF: | C28H38N6O11 | | MW: | 634.63 | | EINECS: | | | Product Categories: | Pepetides | | Mol File: | 216757-29-8.mol |  |
| | AC-IEPD-PNA Chemical Properties |
| Boiling point | 1096.9±65.0 °C(Predicted) | | density | 1.386±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMSO: soluble | | pka | 4.06±0.10(Predicted) | | form | powder | | color | White to off-white | | Sequence | Ac-Ile-Glu-Pro-Asp-{pNA} | | InChIKey | YXEIIOVAGGAMCZ-NYMCBPKFSA-N | | SMILES | CC[C@H](C)[C@H](NC(C)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(O)=O)C(=O)Nc2ccc(cc2)[N+]([O-])=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | AC-IEPD-PNA Usage And Synthesis |
| Uses | N-Acetyl-Ile-Glu-Pro-Asp-p-nitroanilide (Ac-IEPD-pNA) is a granzyme B substrate that allows accurate measurement of granzyme B activity[1]. | | Biological Activity | Primary Target
Colorimetric substrate for granzyme B', 'kcat/Km = 6.6 x 104 M-¹ sec-¹ as substrate for granzyme B | | References | [1] Kristina Fritsch, et al. Suppression of granzyme B activity and caspase-3 activation in leukaemia cells constitutively expressing the protease inhibitor 9. Ann Hematol. 2013 Dec;92(12):1603-9. DOI:10.1007/s00277-013-1846-6 |
| | AC-IEPD-PNA Preparation Products And Raw materials |
|