|
|
| | CHEMBRDG-BB 7022461 Basic information |
| Product Name: | CHEMBRDG-BB 7022461 | | Synonyms: | CHEMBRDG-BB 7022461;TIMTEC-BB SBB010868;3-ALLYL-4-METHOXY-BENZOIC ACID;4-methoxy-3-prop-2-enylbenzoic acid;4-methoxy-3-prop-2-enyl-benzoic acid;3-allyl-4-methoxybenzoic acid(SALTDATA: FREE);Benzoic acid, 4-methoxy-3-(2-propen-1-yl)- | | CAS: | 7501-09-9 | | MF: | C11H12O3 | | MW: | 192.21 | | EINECS: | | | Product Categories: | | | Mol File: | 7501-09-9.mol |  |
| | CHEMBRDG-BB 7022461 Chemical Properties |
| form | solid | | InChI | 1S/C11H12O3/c1-3-4-8-7-9(11(12)13)5-6-10(8)14-2/h3,5-7H,1,4H2,2H3,(H,12,13) | | InChIKey | LGIGQNDSEONVRB-UHFFFAOYSA-N | | SMILES | O=C(O)C1=CC(CC=C)=C(OC)C=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | CHEMBRDG-BB 7022461 Usage And Synthesis |
| | CHEMBRDG-BB 7022461 Preparation Products And Raw materials |
|