| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-Chloro-2-nitrobenzenesulfonyl chloride manufacturers
|
| | 4-Chloro-2-nitrobenzenesulfonyl chloride Basic information |
| Product Name: | 4-Chloro-2-nitrobenzenesulfonyl chloride | | Synonyms: | BENZENESULFONYL CHLORIDE, 4-CHLORO-2-NITRO-;4-chloro-2-nitrophenylsulphonyl chloride;4-Chloro-2-nitrophenylsulfonylchloride;4-chloro-2-nitrobenzene-1-sulfonyl chloride;4-Chloro-2-nitrobenzenesulfonyl chloride 97%;4-chloro-2-nitrophenylsulphonyl chlorid;4-Chloro-2-nitrobenzenesulfonyl chloride | | CAS: | 4533-96-4 | | MF: | C6H3Cl2NO4S | | MW: | 256.06 | | EINECS: | 224-875-5 | | Product Categories: | Intermediates of Dyes and Pigments | | Mol File: | 4533-96-4.mol |  |
| | 4-Chloro-2-nitrobenzenesulfonyl chloride Chemical Properties |
| Melting point | 75-79°C | | Boiling point | 352.7±27.0 °C(Predicted) | | density | 1.708±0.06 g/cm3(Predicted) | | Fp | >110℃ | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Pale Yellow to Pale Beige | | Sensitive | Moisture Sensitive | | Stability: | Hygroscopic | | InChI | 1S/C6H3Cl2NO4S/c7-4-1-2-6(14(8,12)13)5(3-4)9(10)11/h1-3H | | InChIKey | LYESTQKHIPXVIK-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cc(Cl)ccc1S(Cl)(=O)=O |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8 / PGII | | WGK Germany | 1 | | HazardClass | 8 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 4-Chloro-2-nitrobenzenesulfonyl chloride Usage And Synthesis |
| | 4-Chloro-2-nitrobenzenesulfonyl chloride Preparation Products And Raw materials |
|