|
|
| | CHEMBRDG-BB 6617565 Basic information |
| Product Name: | CHEMBRDG-BB 6617565 | | Synonyms: | 2-(4-bromophenyl)-N,N-dimethylacetamide;benzeneacetamide, 4-bromo-N,N-dimethyl-;Albb-009557;2-(4-bromophenyl)-N,N-dimethylacetamide(SALTDATA: FREE);CHEMBRDG-BB 6617565;2-(4-bromophenyl)-N,N-dimethyl-ethanamide;4-Bromo-N,N-dimethyl-benzeneacetamide;2-(4-bromobenzene)-N,N-dimethylacetamide | | CAS: | 19715-80-1 | | MF: | C10H12BrNO | | MW: | 242.11 | | EINECS: | | | Product Categories: | alkyl bromide | | Mol File: | 19715-80-1.mol |  |
| | CHEMBRDG-BB 6617565 Chemical Properties |
| Melting point | 64-66 °C | | Boiling point | 335.9±25.0 °C(Predicted) | | density | 1.377±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | -0.61±0.70(Predicted) | | form | solid | | InChI | 1S/C10H12BrNO/c1-12(2)10(13)7-8-3-5-9(11)6-4-8/h3-6H,7H2,1-2H3 | | InChIKey | CNGVHZAORFMGBW-UHFFFAOYSA-N | | SMILES | O=C(CC1=CC=C(Br)C=C1)N(C)C |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 13 - Non Combustible Solids |
| | CHEMBRDG-BB 6617565 Usage And Synthesis |
| Uses | 2-(4-Bromophenyl)-N,N-dimethylacetamide (cas# 19715-80-1) can be used in the preparation of bicyclic pyridine compositions, which may be used in cancer therapy. |
| | CHEMBRDG-BB 6617565 Preparation Products And Raw materials |
|