| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
VladaChem GmbH |
| Tel: |
+49-7246-3082843 +86-18411632868 |
| Email: |
info@vladachem.de |
4-n-Octoxy benzophenone manufacturers
|
| | 4-n-Octoxy benzophenone Basic information |
| | 4-n-Octoxy benzophenone Chemical Properties |
| InChI | InChI=1S/C21H26O2/c1-2-3-4-5-6-10-17-23-20-15-13-19(14-16-20)21(22)18-11-8-7-9-12-18/h7-9,11-16H,2-6,10,17H2,1H3 | | InChIKey | WTJWFFXZUSGGKB-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(OCCCCCCCC)C=C1)(C1=CC=CC=C1)=O |
| | 4-n-Octoxy benzophenone Usage And Synthesis |
| Uses |
4-n-octoxy benzophenone is mainly used in pharmaceutical synthesis and scientific research.
|
| | 4-n-Octoxy benzophenone Preparation Products And Raw materials |
|