|
|
| | 1,3-BENZODIOXOL-4-AMINE Basic information |
| Product Name: | 1,3-BENZODIOXOL-4-AMINE | | Synonyms: | 1,3-BENZODIOXOL-4-AMINE;2H-1,3-benzodioxol-4-aMine;2,3-Methylenedioxyaniline;Aniline, 2,3-(methylenedioxy)-;benzo[d][1,3]dioxol-4-amine | | CAS: | 1668-84-4 | | MF: | C7H7NO2 | | MW: | 137.14 | | EINECS: | | | Product Categories: | | | Mol File: | 1668-84-4.mol |  |
| | 1,3-BENZODIOXOL-4-AMINE Chemical Properties |
| Melting point | 32-33 °C(Solv: hexane (110-54-3)) | | Boiling point | 100-105 °C(Press: 0.09 Torr) | | density | 1.332±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | powder | | pka | 4.12±0.20(Predicted) | | color | Brown | | InChI | InChI=1S/C7H7NO2/c8-5-2-1-3-6-7(5)10-4-9-6/h1-3H,4,8H2 | | InChIKey | KQMXPHISFRKBJP-UHFFFAOYSA-N | | SMILES | O1C2=CC=CC(N)=C2OC1 |
| | 1,3-BENZODIOXOL-4-AMINE Usage And Synthesis |
| Synthesis | The general procedure for the synthesis of 4-amino-1,3-benzodioxole from tert-butyl benzo[d][1,3]dioxol-4-ylcarbamate was as follows: the Boc-protected feedstock G2 (257 mg, 1.08 mmol) was dissolved in a dioxane solution (5.0 mL) of 4 M HCl and stirred for 1 h at room temperature. Upon completion of the reaction, the solvent was removed by evaporation and the residue was diluted with saturated sodium bicarbonate solution (a few milliliters) and 1 M NaOH solution (1 mL), followed by extraction with ethyl acetate (EtOAc, 2×). The organic phases were combined, dried over anhydrous magnesium sulfate (MgSO), filtered and evaporated to dryness to afford the crude product 2,3-methylenedioxypropane G3 (158 mg, 106% yield). | | References | [1] Patent: WO2004/103996, 2004, A1. Location in patent: Page 50
[2] Journal of Medicinal Chemistry, 2004, vol. 47, # 4, p. 871 - 887
[3] Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1991, # 2, p. 259 - 262
[4] Patent: US2004/34046, 2004, A1
[5] Patent: WO2004/4732, 2004, A1. Location in patent: Page/Page column 66 |
| | 1,3-BENZODIOXOL-4-AMINE Preparation Products And Raw materials |
|