| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Cyano-4-fluorophenylboronic acid, pinacol ester Basic information |
| Product Name: | 3-Cyano-4-fluorophenylboronic acid, pinacol ester | | Synonyms: | Bm369;2-fluoro-5-(tetraMethyl-1,3,2-dioxaborolan-2-yl)benzonitrile;3-Cyano-4-fluorobenzeneboronic acid pinacol ester, 96%;5-Cyano-2-fluorobenzeneboronic acid pinacol ester, 96%;Benzonitrile, 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;2-fluoro-5-(tetraMethyl-1,3,2-dioxaborolan-2-yl)benzonitri;3-Cyano-4-fluorophenylboronic acid, pinacol ester 95+%;2-(3-Cyano-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | CAS: | 775351-57-0 | | MF: | C13H15BFNO2 | | MW: | 247.07 | | EINECS: | | | Product Categories: | Aryl;Organoborons | | Mol File: | 775351-57-0.mol |  |
| | 3-Cyano-4-fluorophenylboronic acid, pinacol ester Chemical Properties |
| Melting point | 75-76℃ | | Boiling point | 334.5±32.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Solid | | color | White to Almost white | | InChI | 1S/C13H15BFNO2/c1-12(2)13(3,4)18-14(17-12)10-5-6-11(15)9(7-10)8-16/h5-7H,1-4H3 | | InChIKey | RYJOVQGRIOURGT-UHFFFAOYSA-N | | SMILES | FC1=C(C#N)C=C(B2OC(C)(C)C(C)(C)O2)C=C1 |
| RIDADR | UN3439 | | WGK Germany | WGK 3 | | HazardClass | 6.1 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | 3-Cyano-4-fluorophenylboronic acid, pinacol ester Usage And Synthesis |
| Synthesis | 2-Fluoro-5-bromobenzonitrile (1000.00 mg, 5.00 mmol, 1.00 eq.) and pinacol ester of bisboronic acid (1396.61 mg, 5.50 mmol, 1.10 eq.) were added to potassium acetate (1472.07 mg, 15.00 mmol, 3.00 eq.) in a dioxane (10 mL) and DMF (1 mL) ) in a solvent mixture of dioxane (10 mL) and DMF (1 mL) for degassing. Subsequently, [1,1'-bis(diphenylphosphino)ferrocene]palladium(II) dichloride 1:1 complex with dichloromethane (366.85 mg, 0.50 mmol, 0.10 eq.) was added. The reaction mixture was placed in a sealed vial and the reaction was heated at 100 °C overnight. After completion of the reaction, it was cooled to room temperature and filtered through a diatomaceous earth pad. The filtrate was concentrated under reduced pressure to remove the solvent, and the resulting crude product was purified by silica gel column chromatography (eluent: ethyl acetate/hexane, gradient 0 to 5%) to afford the target product 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (1.0 g, 81% yield). | | References | [1] Patent: US2016/376283, 2016, A1. Location in patent: Paragraph 0504; 0505; 0506 [2] Patent: WO2011/25799, 2011, A1. Location in patent: Page/Page column 50 [3] Organic Letters, 2004, vol. 6, # 19, p. 3265 - 3268 |
| | 3-Cyano-4-fluorophenylboronic acid, pinacol ester Preparation Products And Raw materials |
|