|
|
| Product Name: | 4-Diethylamino-2-methylbenzaldehyde | | Synonyms: | 4-DIETHYLAMINO O-TOLUALDEHYDE;N,N-Biethyl-4-amino-2-methyl benzaldehyde;4-Diethylamino-2-methylbenzaldehyde;N,N-Diethyl-4-amino-2-methylbenzaldehyde;2-methyl-4-(N,N-diethylamino)benzaldehyde;1,2,3,4,5,6,7,8-Octadeuterionaphthalene;4-Diethylamino-2-met;4-(diethylamino)-2-methylbenzaldehyde(SALTDATA: FREE) | | CAS: | 92-14-8 | | MF: | C12H17NO | | MW: | 191.27 | | EINECS: | 202-130-5 | | Product Categories: | | | Mol File: | 92-14-8.mol |  |
| | 4-Diethylamino-2-methylbenzaldehyde Chemical Properties |
| Boiling point | 322.5±30.0 °C(Predicted) | | density | 1.015±0.06 g/cm3(Predicted) | | pka | 3.51±0.42(Predicted) | | InChI | InChI=1S/C12H17NO/c1-4-13(5-2)12-7-6-11(9-14)10(3)8-12/h6-9H,4-5H2,1-3H3 | | InChIKey | KCZRCYBAYWJVGD-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(N(CC)CC)C=C1C | | EPA Substance Registry System | Benzaldehyde, 4-(diethylamino)-2-methyl- (92-14-8) |
| TSCA | TSCA listed | | HS Code | 28459010 |
| | 4-Diethylamino-2-methylbenzaldehyde Usage And Synthesis |
| ?Safety protection | In case of accident or if you feel unwell, seek medical advice immediately. | | Storage | Store at room temperature | | Uses | 4-Diethylamino-2-methyl-benzaldehyde can be used for phase change inks and colorant manufacture. |
| | 4-Diethylamino-2-methylbenzaldehyde Preparation Products And Raw materials |
|