2,4,8,10-tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide manufacturers
|
| | 2,4,8,10-tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide Basic information |
| Product Name: | 2,4,8,10-tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide | | Synonyms: | 2,4,8,10-tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide;2,4,8,10-tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide 2,4;2,4,8,10-tetraoxa-3λ4,9λ4-dithiaspiro[5.5]undecane 3,9-dioxide;2,4,8,10-tetraoxa-3λ4,9λ4-dithiaspiro[5.5]undecane 3,9-dioxide;2,4,8,10-tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide 2,4,8,10-;Pentaerythritol cyclic disulfite;Pentaerythrit-disulfit;O O' O'' O'''-Disulfinyl-pentaerythrit | | CAS: | 3670-93-7 | | MF: | C5H8O6S2 | | MW: | 228.24 | | EINECS: | 222-933-4 | | Product Categories: | | | Mol File: | 3670-93-7.mol | ![2,4,8,10-tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide Structure](CAS/GIF/3670-93-7.gif) |
| | 2,4,8,10-tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide Chemical Properties |
| Melting point | 151 °C | | Boiling point | 395.1±42.0 °C(Predicted) | | density | 1.88±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C5H8O6S2/c6-12-8-1-5(2-9-12)3-10-13(7)11-4-5/h1-4H2 | | InChIKey | UCFQFMBCPHTKRN-UHFFFAOYSA-N | | SMILES | C1C2(COS(=O)OC2)COS(=O)O1 |
| | 2,4,8,10-tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide Usage And Synthesis |
| Uses | 2,4,8,10-tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide is a bis(spiro) derivative containing two dioxaphosphorinane 2-oxide groupings. Following the rationale that single-ring systems (2-alkylamino and 2-arylamino-5-alkyl-5-nitro-1,3,2-dioxaphosphorinane 2-oxides) exhibit antitumor activity against Walker carcinosarcoma 256, this spiro compound is expected to possess equal or greater antitumor activity than the single-ring systems due to its dual-ring structure.[1] | | References |
[1] Billman, J. H., & May, R. F. (1968). 1,3,2-Dioxaphosphorinane 2-Oxides III. Preparation and Antitumor Evaluation of Some 3,9-Disubstituted-2,4,8,10-Tetraoxa-3,9-Diphosphaspiro[5.5]-Undecane 3,9-Dioxide. Journal of Pharmaceutical Sciences, 57 10, Pages 1812-1814. https://doi.org/10.1002/jps.2600571047
|
| | 2,4,8,10-tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide Preparation Products And Raw materials |
|