Cyanuric acid trisodium salt manufacturers
|
| | Cyanuric acid trisodium salt Basic information |
| Product Name: | Cyanuric acid trisodium salt | | Synonyms: | 1,3,5-triazine-2,4,6(1H,3H,5H)-trione, trisodium salt;Cyanuric acid trisodium salt;1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, sodium salt (1:3);Cyanuricacidtrisodiumsal;Cyanuric acid trisodium salt ISO 9001:2015 REACH | | CAS: | 3047-33-4 | | MF: | C3H4N3NaO3 | | MW: | 153.07 | | EINECS: | 221-255-6 | | Product Categories: | | | Mol File: | 3047-33-4.mol |  |
| | Cyanuric acid trisodium salt Chemical Properties |
| Boiling point | 603.07℃[at 101 325 Pa] | | density | 2.09[at 20℃] | | Water Solubility | 1000g/L at 25℃ | | InChI | InChI=1S/C3H3N3O3.Na.H/c7-1-4-2(8)6-3(9)5-1;;/h(H3,4,5,6,7,8,9);; | | InChIKey | MRABUHOJDXAZPS-UHFFFAOYSA-N | | SMILES | O=C1NC(=O)NC(=O)N1.[NaH] | | LogP | -2.06 | | EPA Substance Registry System | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, trisodium salt (3047-33-4) |
| | Cyanuric acid trisodium salt Usage And Synthesis |
| | Cyanuric acid trisodium salt Preparation Products And Raw materials |
|