| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
bis(8-methylnonyl) phthalate manufacturers
- diisodecyl phthalate
-
- $6.00
-
2024-01-08
- CAS:89-16-7
- Min. Order: 1kg
- Purity: 99.96%
- Supply Ability: 500ton
|
| | bis(8-methylnonyl) phthalate Basic information |
| | bis(8-methylnonyl) phthalate Chemical Properties |
| Boiling point | 425.8±13.0 °C(Predicted) | | density | 0.964±0.06 g/cm3(Predicted) | | refractive index | n20/D1.477-1.481 | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | BRN | 2171889 | | Major Application | cleaning products cosmetics food and beverages personal care | | InChI | 1S/C28H46O4/c1-23(2)17-11-7-5-9-15-21-31-27(29)25-19-13-14-20-26(25)28(30)32-22-16-10-6-8-12-18-24(3)4/h13-14,19-20,23-24H,5-12,15-18,21-22H2,1-4H3 | | InChIKey | ZVFDTKUVRCTHQE-UHFFFAOYSA-N | | SMILES | O(CCCCCCCC(C)C)C(=O)c1c(cccc1)C(=O)OCCCCCCCC(C)C |
| WGK Germany | 1 | | Storage Class | 10 - Combustible liquids |
| | bis(8-methylnonyl) phthalate Usage And Synthesis |
| Chemical Properties | Clear Colorless Oil | | Uses | A phtalate ester found in plastic gasket used in food packaging. Used in environmental toxicology studies as a present contaminant. | | Definition | ChEBI: Diisodecyl phthalate is a phthalate ester and a diester. |
| | bis(8-methylnonyl) phthalate Preparation Products And Raw materials |
|