| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | p-acetamidobenzenesulphonyl fluoride Basic information |
| Product Name: | p-acetamidobenzenesulphonyl fluoride | | Synonyms: | p-acetamidobenzenesulphonyl fluoride;4-(Acetylamino)benzenesulfonyl fluoride;4-acetamidobenzenesulfonyl fluoride;4-Acetamidobenzene-1-sulfonyl fluoride;Benzenesulfonyl fluoride, 4-(acetylamino)-;4-(Acetylamino)benzenesulfonyl fluoride 95%;p-Acetamidobenzenesulfonyl fluoride;N-ACETYLSULFANILYL FLUORIDE | | CAS: | 329-20-4 | | MF: | C8H8FNO3S | | MW: | 217.22 | | EINECS: | 206-343-4 | | Product Categories: | | | Mol File: | 329-20-4.mol |  |
| | p-acetamidobenzenesulphonyl fluoride Chemical Properties |
| Melting point | 173-178 °C | | Boiling point | 386.0±25.0 °C(Predicted) | | density | 1.417±0.06 g/cm3(Predicted) | | pka | 13.82±0.70(Predicted) | | form | solid | | InChI | InChI=1S/C8H8FNO3S/c1-6(11)10-7-2-4-8(5-3-7)14(9,12)13/h2-5H,1H3,(H,10,11) | | InChIKey | HRQHLUBMODFETM-UHFFFAOYSA-N | | SMILES | C1(S(F)(=O)=O)=CC=C(NC(C)=O)C=C1 | | EPA Substance Registry System | Benzenesulfonyl fluoride, 4-(acetylamino)- (329-20-4) |
| | p-acetamidobenzenesulphonyl fluoride Usage And Synthesis |
| Uses | Sulfonyl fluoride motif can be used as a connector for the assembly of -SO2- linked small molecules with proteins or nucleic acids. This new click chemistry approach through sulfates is a complimentary approach to using amides and phosphate groups as linkers. | | reaction suitability | reaction type: click chemistry |
| | p-acetamidobenzenesulphonyl fluoride Preparation Products And Raw materials |
|