- Coconut oil fatty acid
-
- $10.00
-
2026-09-11
- CAS:61788-47-4
- Min. Order: 1ASSAYS
- Purity: 99%
- Supply Ability: 10 ton
|
| | Coconut oil fatty acid Basic information |
| Product Name: | Coconut oil fatty acid | | Synonyms: | Coconut oil fatty acid;Edenor K 8-18 MY;Fatty acids, coco;Cocinic acid;.alpha.-Cocinic acid;3-Benzenedicarboxylic acid, 4-hydroxy-6-methyl-1;Coconut oil acid;(4R,4aR,7S,7aR,12bS)-7-hydroxy-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-11-carboxylic acid | | CAS: | 61788-47-4 | | MF: | C19H21NO5 | | MW: | 0 | | EINECS: | 262-978-7 | | Product Categories: | | | Mol File: | 61788-47-4.mol |  |
| | Coconut oil fatty acid Chemical Properties |
| Melting point | 24-27°C | | Boiling point | 326.2 - 370 °C | | density | 0.87-0.90 g/cm3 | | refractive index | 1.427 - 1.430 | | Odor | Fatty acid odor | | Appearance | White to off-white solid | | Cosmetics Ingredients Functions | SURFACTANT - CLEANSING
SURFACTANT - EMULSIFYING
SKIN CONDITIONING - EMOLLIENT
CLEANSING | | Cosmetic Ingredient Review (CIR) | Coconut oil fatty acid (61788-47-4) | | InChI | InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10) | | InChIKey | WWZKQHOCKIZLMA-UHFFFAOYSA-N | | SMILES | C(CCC(=O)O)CCCC | | EPA Substance Registry System | Coco fatty acids (61788-47-4) |
| | Coconut oil fatty acid Usage And Synthesis |
| Description | Coconut oil has been called "the healthiest oil on earth". As a medium-chain fatty acid, coconut oil has a significantly different effect on human physiology than the more common long-chain fatty acids in our food. The saturated fatty acids in coconut oil are basically medium-chain fatty acids. And meat, milk, eggs, and plants (including almost all vegetable oils), whether saturated or unsaturated, are long-chain fatty acids. | | Uses | Coconut oil fatty acid can be used as reaction raw materials for esters, amines, amides, soaps, etc.; it can be used as an oily component of cosmetics and pharmaceuticals. |
| | Coconut oil fatty acid Preparation Products And Raw materials |
|