| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | 6-nitro-1H,3H-naphtho[1,8-cd]pyran-1,3-dione Basic information |
| Product Name: | 6-nitro-1H,3H-naphtho[1,8-cd]pyran-1,3-dione | | Synonyms: | 5-Nitronaphthalic anhydride;6-nitro-1H,3H-naphtho[1,8-cd]pyran-1,3-dione;4-Nitro-1,8-naphthalenedicarboxylic anhydride;4-Nitronaphthalic anhydride;4-Nitro-1,8-naphthalic anhydride,4-Nitronaphthalene-1,8-dicarboxylic anhydride;4-Nitro-1,8-naphthalic anhydride 95%;NSC 15356;1H,3H-Naphtho[1,8-cd]pyran-1,3-dione, 6-nitro- | | CAS: | 6642-29-1 | | MF: | C12H5NO5 | | MW: | 243.17 | | EINECS: | 229-659-4 | | Product Categories: | | | Mol File: | 6642-29-1.mol | ![6-nitro-1H,3H-naphtho[1,8-cd]pyran-1,3-dione Structure](CAS/GIF/6642-29-1.gif) |
| | 6-nitro-1H,3H-naphtho[1,8-cd]pyran-1,3-dione Chemical Properties |
| Melting point | 226-229 °C (lit.) | | Boiling point | 509.9±33.0 °C(Predicted) | | density | 1.637±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder | | color | Dark yellow | | BRN | 237909 | | InChI | 1S/C12H5NO5/c14-11-7-3-1-2-6-9(13(16)17)5-4-8(10(6)7)12(15)18-11/h1-5H | | InChIKey | LKOZHLXUWUBRDK-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc2C(=O)OC(=O)c3cccc1c23 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2932990090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 6-nitro-1H,3H-naphtho[1,8-cd]pyran-1,3-dione Usage And Synthesis |
| Uses | 4-Nitro-1,8-naphthalic anhydride can be used:- As a precursor to synthesize N-phenyl-amino-1,8-naphthalimide based fluorescent chemosensor to detect nitro-antibiotics at ppb level.
- As a building block to synthesize shape memory polymers due to its ability to undergo Diels-Alder reaction
- As a fluorochrome substrate for nitrogen reductase for noninvasive hypoxia imaging in cancer detection.
- As a precursor to synthesize amphiphilic naphthalimide dyes with good color brilliancy.
|
| | 6-nitro-1H,3H-naphtho[1,8-cd]pyran-1,3-dione Preparation Products And Raw materials |
|