|
|
| | Tazobactam Diphenylmethyl Ester Basic information |
| Product Name: | Tazobactam Diphenylmethyl Ester | | Synonyms: | Tazobactam Diphenylmethyl Ester;Benzhydry 2β-triazolmethyl-2α-methyl-6,6-dihydropernicillanate-1,1-dioxide;Benzhydry 2beta-triazolmethyl-2alpha-methyl-6,6-dihydropernicillanate-1,1-dioxide;(2S,3S,5R)-3-METHYL-7-OXO-3-(1H-1,2,3-TRIAZOLE-1-YLMETHYL)-4 - -THIA-1-AZABICYCLO(3.2.0)-HEPTANE-2-CARBOXYLIC ACID DIPHENYL;1H-1,2,3-Triazole, 4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid deriv.;benzhydryl 2β-<(1,2,3-triazol-1-yl)methyl>-2α-methylpenam-3α-carboxylate 1,1-dioxide;Tazobactam Acid Impurity 13;4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3-methyl-7-oxo-3-(1H-1,2,3-triazol-1-ylmethyl)-, diphenylmethyl ester, 4,4-dioxide, (2S,3S,5R)- | | CAS: | 89789-07-1 | | MF: | C23H22N4O5S | | MW: | 466.51 | | EINECS: | 618-304-2 | | Product Categories: | | | Mol File: | 89789-07-1.mol |  |
| | Tazobactam Diphenylmethyl Ester Chemical Properties |
| Boiling point | 717.5±70.0 °C(Predicted) | | density | 1.47±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 0.85±0.12(Predicted) | | Appearance | White to off-white Solid | | InChIKey | PHGXFQIAGFMIHJ-NWSQWKLXSA-N | | SMILES | N12[C@@]([H])(CC1=O)S(=O)(=O)[C@@](C)(CN1C=CN=N1)[C@@H]2C(OC(C1=CC=CC=C1)C1=CC=CC=C1)=O |
| | Tazobactam Diphenylmethyl Ester Usage And Synthesis |
| Uses | Tazobactam Diphenylmethyl Ester-15N3 is an intermediate used in the synthesis of Tazobactam Sodium Salt-15N3 (T010103), which is a labeled analogue of Tazobactam Sodium Salt (T010100), which is a β-Lactamase inhibitor, used with β-lactam antibiotics to enhance their effect. |
| | Tazobactam Diphenylmethyl Ester Preparation Products And Raw materials |
|