|
|
| | 7-Ethoxyindole Basic information |
| Product Name: | 7-Ethoxyindole | | Synonyms: | 1H-Indole,7-ethoxy-;7-Ethoxyindole in stock Factory;7-Ethoxy 1H indol;7-Ethoxyindole | | CAS: | 927181-96-2 | | MF: | C10H11NO | | MW: | 161.2 | | EINECS: | | | Product Categories: | | | Mol File: | 927181-96-2.mol |  |
| | 7-Ethoxyindole Chemical Properties |
| Boiling point | 309.0±15.0 °C(Predicted) | | density | 1.132±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 16.57±0.30(Predicted) | | Appearance | Light yellow to yellow Liquid | | InChI | InChI=1S/C10H11NO/c1-2-12-9-5-3-4-8-6-7-11-10(8)9/h3-7,11H,2H2,1H3 | | InChIKey | UOFKEBQFRTULGS-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2OCC)C=C1 |
| | 7-Ethoxyindole Usage And Synthesis |
| | 7-Ethoxyindole Preparation Products And Raw materials |
|