R-2-Aminoheptanoic acid manufacturers
|
| | R-2-Aminoheptanoic acid Basic information |
| Product Name: | R-2-Aminoheptanoic acid | | Synonyms: | R-2-Aminoheptanoic acid;D-Homonorleucine;REF DUPL: R-2-Aminoheptanoic acid;R-2-AMinoheptanoic acid R-2-AMinoheptanoic acid;(2R)-2-aminoheptanoic acid;Ra2-aminoheptanoicacid;Heptanoic acid, 2-amino-, (2R)- | | CAS: | 44902-01-4 | | MF: | C7H15NO2 | | MW: | 145.2 | | EINECS: | | | Product Categories: | | | Mol File: | 44902-01-4.mol |  |
| | R-2-Aminoheptanoic acid Chemical Properties |
| Boiling point | 251.0±23.0 °C(Predicted) | | density | 1.017±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.55±0.24(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C7H15NO2/c1-2-3-4-5-6(8)7(9)10/h6H,2-5,8H2,1H3,(H,9,10)/t6-/m1/s1 | | InChIKey | RDFMDVXONNIGBC-ZCFIWIBFSA-N | | SMILES | C(O)(=O)[C@H](N)CCCCC |
| | R-2-Aminoheptanoic acid Usage And Synthesis |
| Definition | ChEBI: (2R)-aminoheptanoic acid is an alpha-amino fatty acid that is heptanoic acid substituted by an amino group at position 2 (the 2R stereoisomer). It has a role as a metabolite. It is functionally related to a heptanoic acid. |
| | R-2-Aminoheptanoic acid Preparation Products And Raw materials |
|