- Boc-D-Cha-OH
-
-
2026-07-09
- CAS:127095-92-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | Boc-beta-cyclohexyl-D-alanine monohydrate Basic information |
| Product Name: | Boc-beta-cyclohexyl-D-alanine monohydrate | | Synonyms: | BOC-D-3-Cyclohexyl Alanine;Boc-D-Cha-OH OR Boc-3-cyclohexyl-D-alanine;Boc-β-cyclohexyl-D-alanine≥ 98% (HPLC, Chiral purity);(Tert-Butoxy)Carbonyl D-Cha-OH;(R)-2-(Boc-amino)-3-cyclohexylpropionic Acid;BOC-BETA-CYCLOHEXYL-D-ALANINE;BOC-BETA-CYCLOHEXYL-D-ALANINE MONOHYDRATE;BOC-BETA-CYCLOHEXYL-D-ALA-OH | | CAS: | 127095-92-5 | | MF: | C14H25NO4 | | MW: | 271.35 | | EINECS: | | | Product Categories: | Peptide | | Mol File: | 127095-92-5.mol |  |
| | Boc-beta-cyclohexyl-D-alanine monohydrate Chemical Properties |
| Melting point | 64-67 °C | | Boiling point | 420.4±28.0 °C(Predicted) | | density | 1.083±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 4.02±0.10(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C14H25NO4/c1-14(2,3)19-13(18)15-11(12(16)17)9-10-7-5-4-6-8-10/h10-11H,4-9H2,1-3H3,(H,15,18)(H,16,17)/t11-/s3 | | InChIKey | MSZQAQJBXGTSHP-LBPXTSNRNA-N | | SMILES | [C@@H](C(=O)O)(NC(=O)OC(C)(C)C)CC1CCCCC1 |&1:0,r| | | CAS DataBase Reference | 127095-92-5(CAS DataBase Reference) |
| WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29225090 |
| | Boc-beta-cyclohexyl-D-alanine monohydrate Usage And Synthesis |
| Chemical Properties | White powder |
| | Boc-beta-cyclohexyl-D-alanine monohydrate Preparation Products And Raw materials |
|