| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
U-99194 MALEATE manufacturers
- U 99194 maleate
-
- $48.00
-
2026-07-15
- CAS:234757-41-6
- Purity: 99.45%
- Supply Ability: 10g
|
| | U-99194 MALEATE Basic information |
| Product Name: | U-99194 MALEATE | | Synonyms: | 5,6-DIMETHOXY-N,N-DIPROPYL-2,3-DIHYDRO-1H-INDEN-2-AMINE MALEATE;U-99194;5,6-Dimethoxy-2-(di-n-propylamino)indan maleate salt;U-99194 maleate salt;5,6-dimethoxy-N,N-dipropyl-2,3-dihydro-1H-inden-2-amine fumarate;U 99194 maleate (PNU 99194);AU-99194 maleate;U 99194 maleate (PNU 99194), D3 antagonist | | CAS: | 234757-41-6 | | MF: | C17H27NO2.C4H4O4 | | MW: | 393.47 | | EINECS: | | | Product Categories: | | | Mol File: | 234757-41-6.mol |  |
| | U-99194 MALEATE Chemical Properties |
| storage temp. | Store at RT | | solubility | H2O: >5mg/mL | | form | solid | | color | white | | Water Solubility | Soluble to 25 mM in water | | InChI | 1S/C17H27NO2.C4H4O4/c1-5-7-18(8-6-2)15-9-13-11-16(19-3)17(20-4)12-14(13)10-15;5-3(6)1-2-4(7)8/h11-12,15H,5-10H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b;2-1- | | InChIKey | FSIQDESGRQTFNN-BTJKTKAUSA-N | | SMILES | OC(=O)\C=C/C(O)=O.CCCN(CCC)C1Cc2cc(OC)c(OC)cc2C1 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | U-99194 MALEATE Usage And Synthesis |
| Uses | U-99194 Maleate Salt is a dopamine D3 antagonist that has shown to increase aggressive behaviors in mice. | | Biochem/physiol Actions | U-99194 is a putative D3 antagonist with a 30-fold preference for the dopamine D3 vs. D2 receptor. |
| | U-99194 MALEATE Preparation Products And Raw materials |
|