|
|
| | (R)-2- BOC-AMINO -γ-BUTYROLACTONE Basic information |
| Product Name: | (R)-2- BOC-AMINO -γ-BUTYROLACTONE | | Synonyms: | (R)-2- BOC-AMINO -γ-BUTYROLACTONE;(R)-tert-butyl 2-oxo-tetrahydrofuran-3-ylcarbamate;(R)-(-)-Alpha-(Boc-Amino)-Gamma-Butyrolactone;Boc-D-homoserine lactone;(R)-2- Boc-AMino -γ-ButyrolaCLone;Boc-D-HoMoser lactone;Boc-dHsl;tert-Butyl N-[(3R)-2-oxotetrahydrofuran-3-yl]carbamate | | CAS: | 67198-86-1 | | MF: | C9H15NO4 | | MW: | 201.22 | | EINECS: | | | Product Categories: | | | Mol File: | 67198-86-1.mol |  |
| | (R)-2- BOC-AMINO -γ-BUTYROLACTONE Chemical Properties |
| Melting point | 115-118 °C(Solv: dichloromethane (75-09-2); methanol (67-56-1)) | | Boiling point | 363.7±31.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.21±0.20(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C9H15NO4/c1-9(2,3)14-8(12)10-6-4-5-13-7(6)11/h6H,4-5H2,1-3H3,(H,10,12)/t6-/m1/s1 | | InChIKey | IMWMFJMYEKHYKG-ZCFIWIBFSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1CCOC1=O |
| | (R)-2- BOC-AMINO -γ-BUTYROLACTONE Usage And Synthesis |
| | (R)-2- BOC-AMINO -γ-BUTYROLACTONE Preparation Products And Raw materials |
|