| Company Name: |
Guangzhou Isun Pharmaceutical Co., Ltd
|
| Tel: |
020-39119399 18927568969 |
| Email: |
isunpharm@qq.com |
| Products Intro: |
Product Name:SR 142948A CAS:184162-21-8 Purity:>=98% (HPLC) Package:5Mg;10Mg;25Mg;50Mg;100Mg;1g;5g;10g;25g
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:SR 142948A CAS:184162-21-8 Purity:>=98% (HPLC) Package:5mg, 25mg Remarks:SML0015
|
| Company Name: |
ChemeGen(Shanghai) Biotechnology Co.,Ltd.
|
| Tel: |
18818260767 |
| Email: |
sales@chemegen.com |
| Products Intro: |
Product Name:SR 142948 hydrochloride Purity:98% Package:10 mg;50 mg;100 mg;500 mg;1 g;5 g;10 g
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:SR 142948A >=98% (HPLC) CAS:184162-21-8 Purity:NULL Package:25mg;5mg Remarks:NULL
|
|
| | SR142948 Basic information |
| Product Name: | SR142948 | | Synonyms: | 2-[[5-(2,6-dimethoxyphenyl)-1-(4-(N-(3-dimethylaminopropyl)-N-methylcarbamoyl)-2-isopropylphenyl)-1H-pyrazole3-carbonyl]amino] adamantane-2-carboxylic acid hydrochloride;SR 142948 hydrochloride;SR 142948A >=98% (HPLC);SR142948A HCl;SR142948A hydrochloride | | CAS: | 184162-21-8 | | MF: | C39H52ClN5O6 | | MW: | 722.32 | | EINECS: | | | Product Categories: | | | Mol File: | 184162-21-8.mol |  |
| | SR142948 Chemical Properties |
| storage temp. | 2-8°C | | solubility | H2O: ≥2mg/mL at warmed to 60°C | | form | powder | | color | white to beige | | Water Solubility | H2O: ≥2mg/mL atwarmed to 60°C | | InChIKey | CUYNEHGBVHUQQW-BVJGGMLGSA-N | | SMILES | Cl.COc1cccc(OC)c1-c2cc(nn2-c3ccc(cc3C(C)C)C(=O)N(C)CCCN(C)C)C(=O)NC4([C@@H]5C[C@H]6C[C@@H](C5)C[C@@H]4C6)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | SR142948 Usage And Synthesis |
| Uses | SR 142948A was used to study the role of neurotensin signaling in intracellular alkanization and expression of IL-8 in human pancreatic cancer cells. | | Definition | ChEBI: 2-[[[5-(2,6-dimethoxyphenyl)-1-[4-[[3-(dimethylamino)propyl-methylamino]-oxomethyl]-2-propan-2-ylphenyl]-3-pyrazolyl]-oxomethyl]amino]-2-adamantanecarboxylic acid is a N-acyl-amino acid. | | Biochem/physiol Actions | SR 142948A is a non-peptide Neurotensin receptor antagonist |
| | SR142948 Preparation Products And Raw materials |
|