| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:Sedoheptulose-7-phosphate barium salt
CAS:2646-35-7
Purity:95% Package:10mg Remarks:S28636
|
| Company Name: |
Chengdu Push Bio-Technology Co., Ltd.
|
| Tel: |
028-85370565-229 18080489829 |
| Email: |
18080489829@163.com |
| Products Intro: |
Product Name:Sedoheptulose 7-phosphate
CAS:2646-35-7
Purity:咨询 Package:1mg
|
|
| | Sedoheptulose-7-phosphate Basic information |
| Product Name: | Sedoheptulose-7-phosphate | | Synonyms: | Sedoheptulose-7-phosphate;(2,3,4,5,7-pentahydroxy-6-oxo-heptoxy)phosphonic acid;D-altro-Heptulose 7-phosphate lithium salt;D-Sedoheptulose 7-phosphate lithium salt;D-Sedoheptulose-7-phosphate barium salt;D-altro-2-Heptulose, 7-(dihydrogen phosphate);Sedoheptulose-7-phosphate barium salt | | CAS: | 2646-35-7 | | MF: | C7H15O10P | | MW: | 290.16 | | EINECS: | | | Product Categories: | | | Mol File: | 2646-35-7.mol |  |
| | Sedoheptulose-7-phosphate Chemical Properties |
| Boiling point | 751.4±70.0 °C(Predicted) | | density | 1.862±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | Solid | | pka | 1.83±0.10(Predicted) | | color | White to yellow | | InChI | 1S/C7H15O10P/c8-1-3(9)5(11)7(13)6(12)4(10)2-17-18(14,15)16/h4-8,10-13H,1-2H2,(H2,14,15,16)/t4-,5-,6-,7+/m1/s1 | | InChIKey | JDTUMPKOJBQPKX-GBNDHIKLSA-N | | SMILES | [P](=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)CO)(O)O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Sedoheptulose-7-phosphate Usage And Synthesis |
| Definition | ChEBI: A ketoheptose phosphate consisting of sedoheptulose having a phosphate group at the 7-position. It is an intermediate metabolite in the pentose phosphate pathway. |
| | Sedoheptulose-7-phosphate Preparation Products And Raw materials |
|