|
|
| | 2-[(Diphenylmethyl)sulfonyl] Acetamide Basic information |
| | 2-[(Diphenylmethyl)sulfonyl] Acetamide Chemical Properties |
| Melting point | 199-201°C | | Boiling point | 572.6±50.0 °C(Predicted) | | density | 1.289±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | pka | 14.52±0.40(Predicted) | | BRN | 9199801 | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C15H15NO3S/c16-14(17)11-20(18,19)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,15H,11H2,(H2,16,17) | | InChIKey | ZESNOWZYHYRSRY-UHFFFAOYSA-N | | SMILES | NC(=O)CS(=O)(=O)C(c1ccccc1)c2ccccc2 |
| WGK Germany | WGK 3 | | HS Code | 2930902000 | | Storage Class | 11 - Combustible Solids |
| | 2-[(Diphenylmethyl)sulfonyl] Acetamide Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A metabolite of Modafinil, a central nervous system vigilance promoting agent, which possesses neuroprotective properties | | Uses | A metabolite of Modafinil (M482500), a central nervous system vigilance promoting agent, which possesses neuroprotective properties. |
| | 2-[(Diphenylmethyl)sulfonyl] Acetamide Preparation Products And Raw materials |
|