|
|
| | 4-Bromo-3-fluoro-2-methylaniline Basic information |
| Product Name: | 4-Bromo-3-fluoro-2-methylaniline | | Synonyms: | 4-Bromo-3-fluoro-2-methylaniline;Benzenamine, 4-bromo-3-fluoro-2-methyl-;4-Bromo-3-fluoro-2-;4-bromo-3-fluoro-2-methyl-aniline - [B82175];Orforglipron impurity 30;4-Bromo-3-fluoro-2-methyl-phenylamine | | CAS: | 127408-03-1 | | MF: | C7H7BrFN | | MW: | 204.04 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 4-Bromo-3-fluoro-2-methylaniline Chemical Properties |
| Boiling point | 244.5±35.0 °C(Predicted) | | density | 1.589±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 2.73±0.10(Predicted) | | form | crystalline solid | | color | Pink | | InChI | InChI=1S/C7H7BrFN/c1-4-6(10)3-2-5(8)7(4)9/h2-3H,10H2,1H3 | | InChIKey | HOFKRNFFIGAFNE-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(Br)C(F)=C1C |
| RIDADR | UN2811 | | HS Code | 2921420090 |
| | 4-Bromo-3-fluoro-2-methylaniline Usage And Synthesis |
| Uses | 4-Bromo-3-fluoro-2-methylaniline can be used as pharmaceutical raw material and organic synthesis raw material. |
| | 4-Bromo-3-fluoro-2-methylaniline Preparation Products And Raw materials |
|