| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
Ethyl 4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylate manufacturers
|
| | Ethyl 4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylate Basic information |
| | Ethyl 4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylate Chemical Properties |
| Melting point | 87 °C | | Boiling point | 374.6±52.0 °C(Predicted) | | density | 1.305±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 0.48±0.10(Predicted) | | color | Light Grey | | Sensitive | Stench | | InChI | InChI=1S/C14H12F3NO2S/c1-3-20-13(19)11-8(2)18-12(21-11)9-4-6-10(7-5-9)14(15,16)17/h4-7H,3H2,1-2H3 | | InChIKey | LPIXRQSYBTUXOQ-UHFFFAOYSA-N | | SMILES | S1C(C(OCC)=O)=C(C)N=C1C1=CC=C(C(F)(F)F)C=C1 | | CAS DataBase Reference | 175277-03-9(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 20/21/22-41-22 | | Safety Statements | 22-36/37/39-24/25-39-26 | | WGK Germany | WGK 3 | | Hazard Note | Irritant/Stench | | HS Code | 2934100090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | Ethyl 4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylate Usage And Synthesis |
| Chemical Properties | Light Brown Solid | | Uses | Intermediate in the production of GW 501516 and its derivatives |
| | Ethyl 4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylate Preparation Products And Raw materials |
|