| Company Name: |
TOSUN PHARM |
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
2-Oxazolecarboxylic acid, 5-ethoxy-4-methyl-, ethyl ester manufacturers
|
| | 2-Oxazolecarboxylic acid, 5-ethoxy-4-methyl-, ethyl ester Basic information |
| Product Name: | 2-Oxazolecarboxylic acid, 5-ethoxy-4-methyl-, ethyl ester | | Synonyms: | ethyl 5-ethoxy-4-methyloxazole-2-carboxylate;Vitamin B6 Impurity 12;ethyl 5-ethoxy-4-methyl-1,3-oxazole-2-carboxylate;Pyridoxine (Vitamin B6) Impurity 54;Vitamin B6 Impurity 17;5-Ethoxy-4-methyloxazole-2-carboxylic acid ethyl ester;Vitamin B6 Impurity 94;Pyridoxine Impurity 34/Ethyl 5-ethoxy-4-methyloxazole-2-carboxylate | | CAS: | 23429-04-1 | | MF: | C9H13NO4 | | MW: | 199.2 | | EINECS: | | | Product Categories: | | | Mol File: | 23429-04-1.mol |  |
| | 2-Oxazolecarboxylic acid, 5-ethoxy-4-methyl-, ethyl ester Chemical Properties |
| Boiling point | 128 °C(Press: 4 Torr) | | density | 1.127±0.06 g/cm3(Predicted) | | pka | -0.93±0.14(Predicted) | | InChI | InChI=1S/C9H13NO4/c1-4-12-8(11)7-10-6(3)9(14-7)13-5-2/h4-5H2,1-3H3 | | InChIKey | PQRKGFMROBZFIM-UHFFFAOYSA-N | | SMILES | O1C(OCC)=C(C)N=C1C(OCC)=O |
| | 2-Oxazolecarboxylic acid, 5-ethoxy-4-methyl-, ethyl ester Usage And Synthesis |
| | 2-Oxazolecarboxylic acid, 5-ethoxy-4-methyl-, ethyl ester Preparation Products And Raw materials |
|