| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
PROGLUMIDE, SODIUM SALT manufacturers
|
| | PROGLUMIDE, SODIUM SALT Basic information |
| Product Name: | PROGLUMIDE, SODIUM SALT | | Synonyms: | DL-4-(BENZOYLAMINO)-5-(DIPROPYLAMINO)-5-OXOPENTANOIC ACID, NA;4-BENZOYLAMINO-5-DIPROPYLAMINO-5-OXOPENTANOIC ACID SODIUM;PROGLUMIDE, SODIUM SALT;4-benzamido-n,n-dipropyl-,sodiumsalt,dl-glutaramicaci;SODIUM;4-BENZAMIDO-5-(DIPROPYLAMINO)-5-OXOPENTANOATE;4-benzamido-5-(dipropylamino)-5-oxopentanoate;4-(Benzoylamino)-5-(dipropylamino)-5-oxopentanoic acid sodium salt;dl-4-benzamido-n,n-dipropylglutaramicacidsodiumsalt | | CAS: | 99247-33-3 | | MF: | C18H27N2NaO4 | | MW: | 358.41 | | EINECS: | | | Product Categories: | | | Mol File: | 99247-33-3.mol |  |
| | PROGLUMIDE, SODIUM SALT Chemical Properties |
| storage temp. | Desiccate at RT | | solubility | H2O: soluble | | form | solid | | color | white | | Water Solubility | Soluble to 100 mM in water | | InChI | 1S/C18H26N2O4.Na/c1-3-12-20(13-4-2)18(24)15(10-11-16(21)22)19-17(23)14-8-6-5-7-9-14;/h5-9,15H,3-4,10-13H2,1-2H3,(H,19,23)(H,21,22);/q;+1/p-1 | | InChIKey | UFMWGCINVOIJSO-UHFFFAOYSA-M | | SMILES | [Na+].CCCN(CCC)C(=O)C(CCC([O-])=O)NC(=O)c1ccccc1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | PROGLUMIDE, SODIUM SALT Usage And Synthesis |
| Uses | Proglumide sodium salt has been used to study the effects of proglumide on macronutrient selection in European sea bass Dicentrarchus labrax, L. | | Biochem/physiol Actions | Proglumide sodium salt is a non-peptide cholecystokinin receptor antagonist that has greater selectivity for the CCKA subtype. It selectively blocks central nervous system effects. Proglumide sodium salt is orally active. | | in vivo | Proglumide (250-750 mg/kg; intraperitoneal injection; adult male Sprague Dawley rats) treatment is significantly effective in ameliorating the seizure activities, cognitive dysfunctions, and cerebral oxidative stress[1]. | Animal Model: | Adult male Sprague Dawley rats (200-250g; 2 months old) are induced status epilepticus (SE)[1] | | Dosage: | 250 mg/kg, 500 mg/kg, and 750mg/kg | | Administration: | Intraperitoneal injection | | Result: | Dose-dependently and significantly increased the latencies to seizure and SE. Significantly and dose-dependently attenuated Li-PC (SE) induced increase in thiobarbituric acid (TBARS) and catalase (CAT), attenuated Li-Pc induced decrease in SOD, and attenuated depletion of GSH and glutathione-S transferase (GST) in the hippocampus and striatum.
|
| | storage | Desiccate at RT |
| | PROGLUMIDE, SODIUM SALT Preparation Products And Raw materials |
|