|
|
| | 2-Diethylaminoethyl hexanoate Basic information |
| Product Name: | 2-Diethylaminoethyl hexanoate | | Synonyms: | HEXANOIC,2-(DIETHYLAMINO)ETHYLESTERCITRATE/DIETHYLAMIMOETHYLHEXANOTE;2-Diethylaminoethyl hexanoate(DA-6);Diethl aminoethyl hexanoate;Diethl aminoethyl hexanoate (DA-6);DA-6 1.6% AS;DA-6(Diethyl aminoethyl hexanoate);2-DIETHYLAMINOETHYL HEXANOATE;2-(Diethylamino)ethyl caproate | | CAS: | 10369-83-2 | | MF: | C12H25NO2 | | MW: | 215.33 | | EINECS: | 600-474-4 | | Product Categories: | | | Mol File: | 10369-83-2.mol |  |
| | 2-Diethylaminoethyl hexanoate Chemical Properties |
| Boiling point | 277 °C | | density | 0.907 | | Fp | 87.5 °C | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 9.25±0.25(Predicted) | | form | Solid | | color | Off-White | | InChI | InChI=1S/C12H25NO2/c1-4-7-8-9-12(14)15-11-10-13(5-2)6-3/h4-11H2,1-3H3 | | InChIKey | AEIJVYPRKAWFPN-UHFFFAOYSA-N | | SMILES | C(OCCN(CC)CC)(=O)CCCCC |
| | 2-Diethylaminoethyl hexanoate Usage And Synthesis |
| Description | 2-diethylaminoethyl hexanoate is a plant growth regulator. It is not expected to be environmentally persistent. Little information is available on its toxicity to biodiversity. 2-diethylaminoethyl hexanoate has a low oral mammalian toxicity. | | Chemical Properties | White Powder | | Uses | 2-Diethylaminoethyl Hexanoate is a compound found in soybean herbicidal safeners. | | Production Methods | The production route for 2-diethylaminoethyl hexanoate is not available in open literature. However, its production route can be inferred from its chemical identity and structure. As an amine ester of hexanoic acid, production would probably follow the standard route used for fatty acid amine esters: manufacturers would start with hexanoic acid or hexanoyl chloride, react it with 2 diethylaminoethanol under acidic or catalytic esterification conditions, and then neutralise, wash, and purify the resulting ester. | | Pesticide Type | Herbicide; Plant Growth Regulator |
| | 2-Diethylaminoethyl hexanoate Preparation Products And Raw materials |
|