|
|
| | 1H-1,2,4-Triazole-5-carboxylicacid,1-methyl-,methylester(9CI) Basic information |
| Product Name: | 1H-1,2,4-Triazole-5-carboxylicacid,1-methyl-,methylester(9CI) | | Synonyms: | 1H-1,2,4-Triazole-5-carboxylicacid,1-methyl-,methylester(9CI);1H-1,2,4-Triazole-5-carboxylic acid, 1-methyl-, methyl ester;methyl 2-methyl-1,2,4-triazole-3-carboxylate;Methyl 1-Methyl-1H-1,2,4-triazole-5-carboxylate | | CAS: | 57031-65-9 | | MF: | C5H7N3O2 | | MW: | 141.13 | | EINECS: | | | Product Categories: | CARBOXYLICESTER | | Mol File: | 57031-65-9.mol |  |
| | 1H-1,2,4-Triazole-5-carboxylicacid,1-methyl-,methylester(9CI) Chemical Properties |
| Melting point | 74-75 °C | | Boiling point | 75 °C(Press: 0.3 Torr) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 1.16±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H7N3O2/c1-8-4(5(9)10-2)6-3-7-8/h3H,1-2H3 | | InChIKey | XOGWSBKYAIGMAS-UHFFFAOYSA-N | | SMILES | N1(C)C(C(OC)=O)=NC=N1 |
| | 1H-1,2,4-Triazole-5-carboxylicacid,1-methyl-,methylester(9CI) Usage And Synthesis |
| | 1H-1,2,4-Triazole-5-carboxylicacid,1-methyl-,methylester(9CI) Preparation Products And Raw materials |
|