- L-carnitrile
-
-
2024-12-24
- CAS:2788-28-5
- Min. Order: 1g
- Purity: 99.9%
- Supply Ability: 20 tons
|
| | D(+)-CARNITINENITRILE CHLORIDE Basic information | | Uses |
| Product Name: | D(+)-CARNITINENITRILE CHLORIDE | | Synonyms: | D(+)-CARNITINENITRILE CHLORIDE;D-CARNITINENITRILE CHLORIDE;(3-cyano-2-hydroxypropyl)trimethyl-,chloride,l-ammoniu;Levocarnitine Impurity 5;3-cyano-2-hydroxy-n,n,n-trimethyl-,chloride,(r)-1-propanaminiu;l-(3-cyano-2-hydroxypropyl)trimethylammoniumchloride;l-carnitinnitrilchlorid;L-carnitine impurity 2 | | CAS: | 2788-28-5 | | MF: | C7H15N2O.Cl | | MW: | 178.66 | | EINECS: | 700-669-5 | | Product Categories: | | | Mol File: | 2788-28-5.mol |  |
| | D(+)-CARNITINENITRILE CHLORIDE Chemical Properties |
| Melting point | 249 °C | | form | Crystalline | | InChI | InChI=1S/C7H11ClN2O2/c1-10(2,5-9)6(8)3-4-7(11)12/h6H,3-4H2,1-2H3 | | InChIKey | RWFHESXUMALJEW-UHFFFAOYSA-N | | SMILES | [O-]C(CCC(Cl)[N+](C)(C)C#N)=O |
| Safety Statements | 24/25 | | Toxicity | mouse,LD50,subcutaneous,300mg/kg (300mg/kg),BEHAVIORAL: CONVULSIONS OR EFFECT ON SEIZURE THRESHOLDLUNGS, THORAX, OR RESPIRATION: CYANOSISBEHAVIORAL: FLUID INTAKE,Acta Biologica et Medica Germanica. Vol. 3, Pg. 28, 1959. |
| Provider | Language |
|
ACROS
| English |
| | D(+)-CARNITINENITRILE CHLORIDE Usage And Synthesis |
| Uses | (2R)-Carnitinenitrile Chloride is used in biological studies to stud the action of carnitine and related compounds on acetylcholine receptors of neurons from Helix aspersa. | | Uses | (2R)-Carnitinenitrile Chloride is used in biological studies to stud the action of carnitine and related compounds on acetylcholine receptors of neurons from Helix aspersa. |
| | D(+)-CARNITINENITRILE CHLORIDE Preparation Products And Raw materials |
|