|
|
| | DL-Carnitine hydrochloride Basic information |
| | DL-Carnitine hydrochloride Chemical Properties |
| Melting point | 197-199 °C | | alpha | -0.2~+0.2°(20℃/D)(c=5,H2O) | | storage temp. | Store below +30°C. | | solubility | Aqueous Base (Slightly), Methanol (Slightly, Heated), Water (Sparingly, Sonicate | | form | Powder, Crystals, Needles and/or Chunks | | color | White to almost white | | PH | 1.8-2.5 (100g/l, H2O) | | Water Solubility | SOLUBLE | | Sensitive | Hygroscopic | | Merck | 14,1849 | | BRN | 4163212 | | Stability: | Hygroscopic | | InChI | 1S/C7H15NO3.ClH/c1-8(2,3)5-6(9)4-7(10)11;/h6,9H,4-5H2,1-3H3;1H | | InChIKey | JXXCENBLGFBQJM-UHFFFAOYSA-N | | SMILES | [Cl-].C[N+](C)(C)CC(O)CC(O)=O | | CAS DataBase Reference | 461-05-2(CAS DataBase Reference) | | EPA Substance Registry System | 1-Propanaminium, 3-carboxy-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) (461-05-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | RTECS | BP2979140 | | TSCA | TSCA listed | | HS Code | 29239000 | | Storage Class | 11 - Combustible Solids | | Toxicity | LD50 subcutaneous in mouse: 6gm/kg |
| | DL-Carnitine hydrochloride Usage And Synthesis |
| Chemical Properties | Crystalline Solid | | Uses | Vitamin (enzyme cofactor). Essential cofactor of fatty acid metabolism; required for the transport of fatty acids through the inner mitochondrial membrane. Synthesized primarily in the liver and kidney; highest concentrations found in heart and skeletal muscle. Dietary sources include red meat, dairy products, beans, avocado. | | Uses | DL-Carnitine is a racemic mixture of the quaternary ammonium stereoisomers biologically active L-carnitine and biologically inactive D-carnitine. DL-Carnitine is used in comparative studies with the pure isomers. | | Brand name | Carni tor (Sigma-Tau). |
| | DL-Carnitine hydrochloride Preparation Products And Raw materials |
|