| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 6-FLUOROISATIN
-
- $1.00
-
2020-01-08
- CAS: 324-03-8
- Min. Order: 1IU
- Purity: 99.0%
- Supply Ability: 100kg
|
| | 6-Fluoroisatin Basic information |
| Product Name: | 6-Fluoroisatin | | Synonyms: | 6-fluoro-2,3-dihydro-1H-indole-2,3-dione;6-fluorolsatin;BUTTPARK 50\07-100;6-FLUORO-1H-INDOLE-2,3-DIONE;6-FLUOROISATIN, 98.5%;6-Fluoroisatine;1H-Indole-2,3-dione, 6-fluoro-;2H-1-Benzopyran-2-one,6-bromo-3,9-dihydro- | | CAS: | 324-03-8 | | MF: | C8H4FNO2 | | MW: | 165.12 | | EINECS: | 1533716-785-6 | | Product Categories: | | | Mol File: | 324-03-8.mol |  |
| | 6-Fluoroisatin Chemical Properties |
| Melting point | 195-196 °C(Solv: acetic acid (64-19-7)) | | density | 1.477±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 8.86±0.20(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C8H4FNO2/c9-4-1-2-5-6(3-4)10-8(12)7(5)11/h1-3H,(H,10,11,12) | | InChIKey | CWVFOAVBTUHQCZ-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC(F)=C2)C(=O)C1=O |
| | 6-Fluoroisatin Usage And Synthesis |
| | 6-Fluoroisatin Preparation Products And Raw materials |
|