| Company Name: |
Chengdu Youngshe Chemical Co., Ltd. |
| Tel: |
+8618108235634 |
| Email: |
Cecilia@youngshechem.com |
| Products Intro: |
Product Name:Senecionine N-Oxide;[1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-de
CAS:13268-67-2
Purity:0.98 Package:1G;10G
|
|
|
|
|
|
| Product Name: | senecionine N-oxide | | Synonyms: | senecionine N-oxide;12-Hydroxysenecionan-11,16-dione 4-oxide;Senecionine oxide;Senecionin-N-oxid;[1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-5,6-dimethyl-, 12-oxide, (3Z,5R,6R,14aR,14bR)-;Senecionine N-Oxide-D3Q: What is
Senecionine N-Oxide-D3 Q: What is the CAS Number of
Senecionine N-Oxide-D3;SenecionineN-oxide-RM;[1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-de | | CAS: | 13268-67-2 | | MF: | C18H25NO6 | | MW: | 351.39 | | EINECS: | | | Product Categories: | | | Mol File: | 13268-67-2.mol |  |
| | senecionine N-oxide Chemical Properties |
| form | Solid | | pka | 12.77±0.40(Predicted) | | color | White to off-white | | InChI | InChI=1S/C18H25NO6/c1-4-12-9-11(2)18(3,22)17(21)24-10-13-5-7-19(23)8-6-14(15(13)19)25-16(12)20/h4-5,11,14-15,22H,6-10H2,1-3H3/b12-4-/t11-,14-,15-,18-,19/m1/s1 | | InChIKey | PLGBHVNNYDZWGZ-GPUZEBNTSA-N | | SMILES | [N+]12([O-])CC=C3COC(=O)[C@@](O)(C)[C@H](C)C/C(=C/C)/C(=O)O[C@@]([H])([C@]13[H])CC2 |
| RIDADR | 1544 | | HazardClass | 6.1(a) | | PackingGroup | II |
| | senecionine N-oxide Usage And Synthesis |
| Description | Senecionine N-oxide is a tertiary amine oxide. It derives from a senecionine.
| | Uses | Senecionine N-oxide is the major pyrrolizidine alkaloid in Senecio vulgaris, a native herb of the British Isles. Senecionine N-oxide is hepatotoxic, and is suspected to be an antifertility agent in rats. Despite its toxicity, it is also being regarded as an antiproliferative agent for tumour growth. | | Definition | ChEBI: Senecionine N-oxide is a tertiary amine oxide. It is functionally related to a senecionine. |
| | senecionine N-oxide Preparation Products And Raw materials |
|