|
|
| | propranolol glycol Basic information |
| Product Name: | propranolol glycol | | Synonyms: | 1,2-Dihydroxy-3-(1-naphthoxy)propane;3-(1-Naphthalenyloxy)-1,2-propanediol;3-(1-Naphtyloxy)propane-1,2-diol;Propanolol glycol;3-(naphthalen-1-yloxy)propane-1,2-diol;Propranolol iMpurity A, diol derivative;3-(1-Naphthyloxy)-1,2-propanediol;Propranolol Impurity A | | CAS: | 36112-95-5 | | MF: | C13H14O3 | | MW: | 218.25 | | EINECS: | | | Product Categories: | Amines, Aromatics, Impurities, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 36112-95-5.mol |  |
| | propranolol glycol Chemical Properties |
| Melting point | 99-100℃ | | Boiling point | 437.7±25.0 °C(Predicted) | | density | 1.240±0.06 g/cm3(Predicted) | | storage temp. | 2-30°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Sparingly) | | pka | 13.48±0.20(Predicted) | | BRN | 2107930 | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C13H14O3/c14-8-11(15)9-16-13-7-3-5-10-4-1-2-6-12(10)13/h1-7,11,14-15H,8-9H2 | | InChIKey | BYNNMWGWFIGTIC-UHFFFAOYSA-N | | SMILES | O(CC(O)CO)c1c2c(ccc1)cccc2 |
| Hazard Codes | Xn | | Risk Statements | 21 | | Safety Statements | 36/37 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 1 | | RTECS | TZ0800000 | | HS Code | 2909490000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal |
| | propranolol glycol Usage And Synthesis |
| Uses | 3-(1-Naphthalenyloxy)-1,2-propanediol is an impurity of Propranolol (P831800), an βAdrenergic blocker used as a antihypertensive and antilanginal agent. |
| | propranolol glycol Preparation Products And Raw materials |
|