|
|
| | 2-Amino-4,7-dihydro-5H-thieno[2,3-c]pyran-3-carboxylic acid ethyl ester Basic information |
| Product Name: | 2-Amino-4,7-dihydro-5H-thieno[2,3-c]pyran-3-carboxylic acid ethyl ester | | Synonyms: | Ethyl 2-aMino-4,7-dihydro...;Ethyl 2-aMino-4,7-dihydro-5H-thieno[2,3-c]pyran-3-carboxylate;Ethyl 2-aMino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate;Ethyl 2-aMino-4H,5H,7H-thieno[2,3-c]pyran-3-carboxylate;5H-Thieno[2,3-c]pyran-3-carboxylic acid, 2-amino-4,7-dihydro-, ethyl ester;2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylic acid ethyl ester;ethyl 2-amino-4,5,7,7a-tetrahydro-3aH-thieno[2,3-c]pyran-3-carboxylate;2-Amino-4,7-dihydro-5H-thieno[2,3-c]pyran-3-carboxylic acid ethyl ester | | CAS: | 117642-16-7 | | MF: | C10H13NO3S | | MW: | 227.28 | | EINECS: | 200-258-5 | | Product Categories: | Thiophene | | Mol File: | 117642-16-7.mol | ![2-Amino-4,7-dihydro-5H-thieno[2,3-c]pyran-3-carboxylic acid ethyl ester Structure](CAS/GIF/117642-16-7.gif) |
| | 2-Amino-4,7-dihydro-5H-thieno[2,3-c]pyran-3-carboxylic acid ethyl ester Chemical Properties |
| Melting point | 117-118 °C | | Boiling point | 431.8±45.0 °C(Predicted) | | density | 1.310±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 0.23±0.20(Predicted) | | Appearance | Light yellow to brown Solid | | InChI | InChI=1S/C10H13NO3S/c1-2-14-10(12)8-6-3-4-13-5-7(6)15-9(8)11/h2-5,11H2,1H3 | | InChIKey | RRKGPBYCHQFJEG-UHFFFAOYSA-N | | SMILES | C1OCCC2C(C(OCC)=O)=C(N)SC1=2 |
| | 2-Amino-4,7-dihydro-5H-thieno[2,3-c]pyran-3-carboxylic acid ethyl ester Usage And Synthesis |
| Uses | Ethyl 2-amino-4H,5H,7H-thieno[2,3-c]pyran-3-carboxylate is a NDMA receptor function inhibitor. |
| | 2-Amino-4,7-dihydro-5H-thieno[2,3-c]pyran-3-carboxylic acid ethyl ester Preparation Products And Raw materials |
|