| Company Name: |
Suzhou Highfine Biotech Co., Ltd Gold
|
| Tel: |
0512-68417696 13962195629 |
| Email: |
minhan.zhao@highfine.com |
| Products Intro: |
Product Name:3,5-dimethylpyrazole-1-carboxamidine
CAS:22906-75-8
Purity:>=98% HPLC Package:50g；100g；500g；1kg；10kg；25kg
|
| Company Name: |
Capot Chemical Co., Ltd
|
| Tel: |
+86 (0) 571 85 58 67 18 |
| Email: |
|
| Products Intro: |
Product Name:3,5-Dimethylpyrazole-1-carboxamidine
CAS:22906-75-8
Purity:98% Package:1G;5G;10G;25G Remarks:Cat No.:14759
|
|
| | 3,5-dimethylpyrazole-1-carboxamidine Basic information |
| Product Name: | 3,5-dimethylpyrazole-1-carboxamidine | | Synonyms: | 3,5-dimethylpyrazole-1-carboxamidine;3,5-dimethyl-1H-pyrazole-1-carboximidamide;3,5-dimethyl-1-pyrazolecarboximidamide;1H-Pyrazole-1-carboximidamide, 3,5-dimethyl- | | CAS: | 22906-75-8 | | MF: | C6H10N4 | | MW: | 138.17 | | EINECS: | | | Product Categories: | | | Mol File: | 22906-75-8.mol |  |
| | 3,5-dimethylpyrazole-1-carboxamidine Chemical Properties |
| InChI | InChI=1S/C6H10N4/c1-4-3-5(2)10(9-4)6(7)8/h3H,1-2H3,(H3,7,8) | | InChIKey | GAZRNXIMWKZADY-UHFFFAOYSA-N | | SMILES | N1(C(N)=N)C(C)=CC(C)=N1 |
| | 3,5-dimethylpyrazole-1-carboxamidine Usage And Synthesis |
| | 3,5-dimethylpyrazole-1-carboxamidine Preparation Products And Raw materials |
|